C27H27F6N3O4S — CID 159880735
1-[2-[(1R,2R,5S)-2-[4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(1,1,2,2,2-pentafluoroethyl)-1,3-oxazol-5-yl]-5-fluorocyclohexyl]-2-oxoethyl]cyclopropane-1-carbonitrile (PubChem CID 159880735) has the molecular formula C27H27F6N3O4S and a molecular weight of 603.59 g/mol. Its IUPAC name is 1-[2-[(1R,2R,5S)-2-[4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(1,1,2,2,2-pentafluoroethyl)-1,3-oxazol-5-yl]-5-fluorocyclohexyl]-2-oxoethyl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[2-[(1R,2R,5S)-2-[4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(1,1,2,2,2-pentafluoroethyl)-1,3-oxazol-5-yl]-5-fluorocyclohexyl]-2-oxoethyl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 159880735 |
| Molecular Formula | C27H27F6N3O4S |
| Molecular Weight | 603.59 g/mol |
| Exact Mass | 603.16 |
| IUPAC Name | 1-[2-[(1R,2R,5S)-2-[4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(1,1,2,2,2-pentafluoroethyl)-1,3-oxazol-5-yl]-5-fluorocyclohexyl]-2-oxoethyl]cyclopropane-1-carbonitrile |
| SMILES | N#CC1(CC(=O)[C@@H]2C[C@@H](F)CC[C@H]2c2oc(C(F)(F)C(F)(F)F)nc2-c2ccc(N3CCS(=O)(=O)CC3)cc2)CC1 |
| InChI | InChI=1S/C27H27F6N3O4S/c28-17-3-6-19(20(13-17)21(37)14-25(15-34)7-8-25)23-22(35-24(40-23)26(29,30)27(31,32)33)16-1-4-18(5-2-16)36-9-11-41(38,39)12-10-36/h1-2,4-5,17,19-20H,3,6-14H2/t17-,19+,20+/m0/s1 |
| InChIKey | NTMJMIYFMXDREP-DFQSSKMNSA-N |
| XLogP | 5.72 |
| TPSA | 104.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.59 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|