About 1-iodoazepan-3-ol
1-iodoazepan-3-ol (PubChem CID 153050847) has the molecular formula C6H12INO
and a molecular weight of 241.07 g/mol. Its IUPAC name is 1-iodoazepan-3-ol.
Molecular Properties
| Compound Name | 1-iodoazepan-3-ol |
| PubChem CID | 153050847 |
| Molecular Formula | C6H12INO |
| Molecular Weight | 241.07 g/mol |
| Exact Mass | 241.00 |
| IUPAC Name | 1-iodoazepan-3-ol |
| SMILES | OC1CCCCN(I)C1 |
| InChI | InChI=1S/C6H12INO/c7-8-4-2-1-3-6(9)5-8/h6,9H,1-5H2 |
| InChIKey | VHNGUNZSQZZBDM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.07 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-iodoazepan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodoazepan-3-ol?
The IUPAC name of 1-iodoazepan-3-ol (CID 153050847) is 1-iodoazepan-3-ol.
What is the SMILES notation for 1-iodoazepan-3-ol?
The canonical SMILES for 1-iodoazepan-3-ol is OC1CCCCN(I)C1.
What is the InChIKey of 1-iodoazepan-3-ol?
The InChIKey is VHNGUNZSQZZBDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12INO/c7-8-4-2-1-3-6(9)5-8/h6,9H,1-5H2.
What are the key properties of 1-iodoazepan-3-ol?
1-iodoazepan-3-ol has a molecular weight of 241.07 g/mol, XLogP of 1.18, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodoazepan-3-ol is sourced from PubChem (CID 153050847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).