C32H29F5N4O2 — CID 153062371
3-[2-[(2R)-1-(3,5-difluorophenyl)-5-[7-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]-4-oxopentan-2-yl]-3-pyridinyl]benzamide (PubChem CID 153062371) has the molecular formula C32H29F5N4O2 and a molecular weight of 596.60 g/mol. Its IUPAC name is 3-[2-[(2R)-1-(3,5-difluorophenyl)-5-[7-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]-4-oxopentan-2-yl]-3-pyridinyl]benzamide.
| Compound Name | 3-[2-[(2R)-1-(3,5-difluorophenyl)-5-[7-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]-4-oxopentan-2-yl]-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 153062371 |
| Molecular Formula | C32H29F5N4O2 |
| Molecular Weight | 596.60 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | 3-[2-[(2R)-1-(3,5-difluorophenyl)-5-[7-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]-4-oxopentan-2-yl]-3-pyridinyl]benzamide |
| SMILES | CC1CCCc2c(C(F)(F)F)nn(CC(=O)C[C@@H](Cc3cc(F)cc(F)c3)c3ncccc3-c3cccc(C(N)=O)c3)c21 |
| InChI | InChI=1S/C32H29F5N4O2/c1-18-5-2-8-27-29(18)41(40-30(27)32(35,36)37)17-25(42)15-22(11-19-12-23(33)16-24(34)13-19)28-26(9-4-10-39-28)20-6-3-7-21(14-20)31(38)43/h3-4,6-7,9-10,12-14,16,18,22H,2,5,8,11,15,17H2,1H3,(H2,38,43)/t18?,22-/m1/s1 |
| InChIKey | VJRUCSQBKOVHGI-LMNIDFBRSA-N |
| XLogP | 6.77 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.60 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |