C13H9F8NO — CID 15306735
(Z)-3-amino-4,4,5,5,6,6,7,7-octafluoro-1-phenylhept-2-en-1-one (PubChem CID 15306735) has the molecular formula C13H9F8NO and a molecular weight of 347.21 g/mol. Its IUPAC name is (Z)-3-amino-4,4,5,5,6,6,7,7-octafluoro-1-phenylhept-2-en-1-one.
| Compound Name | (Z)-3-amino-4,4,5,5,6,6,7,7-octafluoro-1-phenylhept-2-en-1-one |
|---|---|
| PubChem CID | 15306735 |
| Molecular Formula | C13H9F8NO |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | (Z)-3-amino-4,4,5,5,6,6,7,7-octafluoro-1-phenylhept-2-en-1-one |
| SMILES | N/C(=C\C(=O)c1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C13H9F8NO/c14-10(15)12(18,19)13(20,21)11(16,17)9(22)6-8(23)7-4-2-1-3-5-7/h1-6,10H,22H2/b9-6- |
| InChIKey | NJGQOBOYSZYJMP-TWGQIWQCSA-N |
| XLogP | 3.88 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|