C11H15N5 — CID 15307832
3-(3-imidazol-1-ylpropyl)-5,6-dimethyl-1,2,4-triazine (PubChem CID 15307832) has the molecular formula C11H15N5 and a molecular weight of 217.28 g/mol. Its IUPAC name is 3-(3-imidazol-1-ylpropyl)-5,6-dimethyl-1,2,4-triazine.
| Compound Name | 3-(3-imidazol-1-ylpropyl)-5,6-dimethyl-1,2,4-triazine |
|---|---|
| PubChem CID | 15307832 |
| Molecular Formula | C11H15N5 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 3-(3-imidazol-1-ylpropyl)-5,6-dimethyl-1,2,4-triazine |
| SMILES | Cc1nnc(CCCn2ccnc2)nc1C |
| InChI | InChI=1S/C11H15N5/c1-9-10(2)14-15-11(13-9)4-3-6-16-7-5-12-8-16/h5,7-8H,3-4,6H2,1-2H3 |
| InChIKey | GHHUQKHXFDAZPG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |