C19H19NO6 — CID 15309460
8a-O-benzyl 2-O-methyl (4aR,8aS)-1,6-dioxo-3,4,4a,5-tetrahydroisoquinoline-2,8a-dicarboxylate (PubChem CID 15309460) has the molecular formula C19H19NO6 and a molecular weight of 357.36 g/mol. Its IUPAC name is 8a-O-benzyl 2-O-methyl (4aR,8aS)-1,6-dioxo-3,4,4a,5-tetrahydroisoquinoline-2,8a-dicarboxylate.
| Compound Name | 8a-O-benzyl 2-O-methyl (4aR,8aS)-1,6-dioxo-3,4,4a,5-tetrahydroisoquinoline-2,8a-dicarboxylate |
|---|---|
| PubChem CID | 15309460 |
| Molecular Formula | C19H19NO6 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 8a-O-benzyl 2-O-methyl (4aR,8aS)-1,6-dioxo-3,4,4a,5-tetrahydroisoquinoline-2,8a-dicarboxylate |
| SMILES | COC(=O)N1CC[C@@H]2CC(=O)C=C[C@]2(C(=O)OCc2ccccc2)C1=O |
| InChI | InChI=1S/C19H19NO6/c1-25-18(24)20-10-8-14-11-15(21)7-9-19(14,16(20)22)17(23)26-12-13-5-3-2-4-6-13/h2-7,9,14H,8,10-12H2,1H3/t14-,19-/m1/s1 |
| InChIKey | CVGWSFSLUURGGX-AUUYWEPGSA-N |
| XLogP | 1.86 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|