C24H32O13 — CID 15310502
triethyl [5-(1,3-diethoxy-2-ethoxycarbonyl-1,3-dioxopropan-2-yl)furan-2-yl]methanetricarboxylate (PubChem CID 15310502) has the molecular formula C24H32O13 and a molecular weight of 528.51 g/mol. Its IUPAC name is triethyl [5-(1,3-diethoxy-2-ethoxycarbonyl-1,3-dioxopropan-2-yl)furan-2-yl]methanetricarboxylate.
| Compound Name | triethyl [5-(1,3-diethoxy-2-ethoxycarbonyl-1,3-dioxopropan-2-yl)furan-2-yl]methanetricarboxylate |
|---|---|
| PubChem CID | 15310502 |
| Molecular Formula | C24H32O13 |
| Molecular Weight | 528.51 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | triethyl [5-(1,3-diethoxy-2-ethoxycarbonyl-1,3-dioxopropan-2-yl)furan-2-yl]methanetricarboxylate |
| SMILES | CCOC(=O)C(C(=O)OCC)(C(=O)OCC)c1ccc(C(C(=O)OCC)(C(=O)OCC)C(=O)OCC)o1 |
| InChI | InChI=1S/C24H32O13/c1-7-31-17(25)23(18(26)32-8-2,19(27)33-9-3)15-13-14-16(37-15)24(20(28)34-10-4,21(29)35-11-5)22(30)36-12-6/h13-14H,7-12H2,1-6H3 |
| InChIKey | MEDOCMKHWNREHJ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 170.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.51 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|