C12H17F3O4Si — CID 10757321
ethyl (2S)-3,3,3-trifluoro-2-hydroxy-2-(5-trimethylsilylfuran-2-yl)propanoate (PubChem CID 10757321) has the molecular formula C12H17F3O4Si and a molecular weight of 310.34 g/mol. Its IUPAC name is ethyl (2S)-3,3,3-trifluoro-2-hydroxy-2-(5-trimethylsilylfuran-2-yl)propanoate.
| Compound Name | ethyl (2S)-3,3,3-trifluoro-2-hydroxy-2-(5-trimethylsilylfuran-2-yl)propanoate |
|---|---|
| PubChem CID | 10757321 |
| Molecular Formula | C12H17F3O4Si |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | ethyl (2S)-3,3,3-trifluoro-2-hydroxy-2-(5-trimethylsilylfuran-2-yl)propanoate |
| SMILES | CCOC(=O)[C@@](O)(c1ccc([Si](C)(C)C)o1)C(F)(F)F |
| InChI | InChI=1S/C12H17F3O4Si/c1-5-18-10(16)11(17,12(13,14)15)8-6-7-9(19-8)20(2,3)4/h6-7,17H,5H2,1-4H3/t11-/m0/s1 |
| InChIKey | SPTYROSLSCXFSZ-NSHDSACASA-N |
| XLogP | 2.14 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|