C14H17FN3O2S+ — CID 153118891
[3-fluoro-4-[4-(3-methylsulfonylphenyl)pyrazol-1-yl]but-2-enyl]azanium (PubChem CID 153118891) has the molecular formula C14H17FN3O2S+ and a molecular weight of 310.37 g/mol. Its IUPAC name is [3-fluoro-4-[4-(3-methylsulfonylphenyl)pyrazol-1-yl]but-2-enyl]azanium.
| Compound Name | [3-fluoro-4-[4-(3-methylsulfonylphenyl)pyrazol-1-yl]but-2-enyl]azanium |
|---|---|
| PubChem CID | 153118891 |
| Molecular Formula | C14H17FN3O2S+ |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | [3-fluoro-4-[4-(3-methylsulfonylphenyl)pyrazol-1-yl]but-2-enyl]azanium |
| SMILES | CS(=O)(=O)c1cccc(-c2cnn(CC(F)=CC[NH3+])c2)c1 |
| InChI | InChI=1S/C14H16FN3O2S/c1-21(19,20)14-4-2-3-11(7-14)12-8-17-18(9-12)10-13(15)5-6-16/h2-5,7-9H,6,10,16H2,1H3/p+1 |
| InChIKey | VULIYTQTQCAQNW-UHFFFAOYSA-O |
| XLogP | 1.05 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |