C28H35FN2O3 — CID 153120967
2-(2-cyclopropyl-4-fluorophenyl)-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 153120967) has the molecular formula C28H35FN2O3 and a molecular weight of 466.60 g/mol. Its IUPAC name is 2-(2-cyclopropyl-4-fluorophenyl)-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | 2-(2-cyclopropyl-4-fluorophenyl)-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 153120967 |
| Molecular Formula | C28H35FN2O3 |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | 2-(2-cyclopropyl-4-fluorophenyl)-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | O=C(O)C(c1ccc(F)cc1C1CC1)N1CC[C@@H](OCCCCc2ccc3c(n2)CCCC3)C1 |
| InChI | InChI=1S/C28H35FN2O3/c29-21-11-13-24(25(17-21)19-8-9-19)27(28(32)33)31-15-14-23(18-31)34-16-4-3-6-22-12-10-20-5-1-2-7-26(20)30-22/h10-13,17,19,23,27H,1-9,14-16,18H2,(H,32,33)/t23-,27?/m1/s1 |
| InChIKey | VUVLVPHXISAISK-BRIWLPCBSA-N |
| XLogP | 5.22 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|