About N-[[1-(6,7-dimethylquinazolin-4-yl)piperidin-3-yl]methyl]methanesulfonamide
N-[[1-(6,7-dimethylquinazolin-4-yl)piperidin-3-yl]methyl]methanesulfonamide (PubChem CID 153125993) has the molecular formula C17H24N4O2S
and a molecular weight of 348.47 g/mol. Its IUPAC name is N-[[1-(6,7-dimethylquinazolin-4-yl)piperidin-3-yl]methyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[[1-(6,7-dimethylquinazolin-4-yl)piperidin-3-yl]methyl]methanesulfonamide |
| PubChem CID | 153125993 |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N-[[1-(6,7-dimethylquinazolin-4-yl)piperidin-3-yl]methyl]methanesulfonamide |
| SMILES | Cc1cc2ncnc(N3CCCC(CNS(C)(=O)=O)C3)c2cc1C |
| InChI | InChI=1S/C17H24N4O2S/c1-12-7-15-16(8-13(12)2)18-11-19-17(15)21-6-4-5-14(10-21)9-20-24(3,22)23/h7-8,11,14,20H,4-6,9-10H2,1-3H3 |
| InChIKey | VVUQDQCMEMSRDC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[1-(6,7-dimethylquinazolin-4-yl)piperidin-3-yl]methyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(6,7-dimethylquinazolin-4-yl)piperidin-3-yl]methyl]methanesulfonamide?
The IUPAC name of N-[[1-(6,7-dimethylquinazolin-4-yl)piperidin-3-yl]methyl]methanesulfonamide (CID 153125993) is N-[[1-(6,7-dimethylquinazolin-4-yl)piperidin-3-yl]methyl]methanesulfonamide.
What is the SMILES notation for N-[[1-(6,7-dimethylquinazolin-4-yl)piperidin-3-yl]methyl]methanesulfonamide?
The canonical SMILES for N-[[1-(6,7-dimethylquinazolin-4-yl)piperidin-3-yl]methyl]methanesulfonamide is Cc1cc2ncnc(N3CCCC(CNS(C)(=O)=O)C3)c2cc1C.
What is the InChIKey of N-[[1-(6,7-dimethylquinazolin-4-yl)piperidin-3-yl]methyl]methanesulfonamide?
The InChIKey is VVUQDQCMEMSRDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N4O2S/c1-12-7-15-16(8-13(12)2)18-11-19-17(15)21-6-4-5-14(10-21)9-20-24(3,22)23/h7-8,11,14,20H,4-6,9-10H2,1-3H3.
What are the key properties of N-[[1-(6,7-dimethylquinazolin-4-yl)piperidin-3-yl]methyl]methanesulfonamide?
N-[[1-(6,7-dimethylquinazolin-4-yl)piperidin-3-yl]methyl]methanesulfonamide has a molecular weight of 348.47 g/mol, XLogP of 2.01, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(6,7-dimethylquinazolin-4-yl)piperidin-3-yl]methyl]methanesulfonamide is sourced from PubChem (CID 153125993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).