C35H31NO — CID 15312838
[(2S,3S)-3-methyl-1-tritylaziridin-2-yl]-diphenylmethanol (PubChem CID 15312838) has the molecular formula C35H31NO and a molecular weight of 481.64 g/mol. Its IUPAC name is [(2S,3S)-3-methyl-1-tritylaziridin-2-yl]-diphenylmethanol.
| Compound Name | [(2S,3S)-3-methyl-1-tritylaziridin-2-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 15312838 |
| Molecular Formula | C35H31NO |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | [(2S,3S)-3-methyl-1-tritylaziridin-2-yl]-diphenylmethanol |
| SMILES | C[C@H]1[C@@H](C(O)(c2ccccc2)c2ccccc2)N1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H31NO/c1-27-33(35(37,31-23-13-5-14-24-31)32-25-15-6-16-26-32)36(27)34(28-17-7-2-8-18-28,29-19-9-3-10-20-29)30-21-11-4-12-22-30/h2-27,33,37H,1H3/t27-,33-,36?/m0/s1 |
| InChIKey | OTVDKPUPMNOGSK-HVZFRMHZSA-N |
| XLogP | 6.99 |
| TPSA | 23.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|