C12H21N3O5 — CID 153132223
3-amino-2-(1-aminoethyl)-5-methyl-4-(prop-2-enoylamino)hexanedioic acid (PubChem CID 153132223) has the molecular formula C12H21N3O5 and a molecular weight of 287.32 g/mol. Its IUPAC name is 3-amino-2-(1-aminoethyl)-5-methyl-4-(prop-2-enoylamino)hexanedioic acid.
| Compound Name | 3-amino-2-(1-aminoethyl)-5-methyl-4-(prop-2-enoylamino)hexanedioic acid |
|---|---|
| PubChem CID | 153132223 |
| Molecular Formula | C12H21N3O5 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 3-amino-2-(1-aminoethyl)-5-methyl-4-(prop-2-enoylamino)hexanedioic acid |
| SMILES | C=CC(=O)NC(C(C)C(=O)O)C(N)C(C(=O)O)C(C)N |
| InChI | InChI=1S/C12H21N3O5/c1-4-7(16)15-10(5(2)11(17)18)9(14)8(6(3)13)12(19)20/h4-6,8-10H,1,13-14H2,2-3H3,(H,15,16)(H,17,18)(H,19,20) |
| InChIKey | VWYSQTLEPKWTOE-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 155.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|