C25H35NO3S — CID 153142459
2-methyl-4-[4-[3-methyl-4-(4-methylpent-1-ynyl)phenyl]cyclohex-3-en-1-yl]-2-methylsulfonylbutanamide (PubChem CID 153142459) has the molecular formula C25H35NO3S and a molecular weight of 429.63 g/mol. Its IUPAC name is 2-methyl-4-[4-[3-methyl-4-(4-methylpent-1-ynyl)phenyl]cyclohex-3-en-1-yl]-2-methylsulfonylbutanamide.
| Compound Name | 2-methyl-4-[4-[3-methyl-4-(4-methylpent-1-ynyl)phenyl]cyclohex-3-en-1-yl]-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 153142459 |
| Molecular Formula | C25H35NO3S |
| Molecular Weight | 429.63 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 2-methyl-4-[4-[3-methyl-4-(4-methylpent-1-ynyl)phenyl]cyclohex-3-en-1-yl]-2-methylsulfonylbutanamide |
| SMILES | Cc1cc(C2=CCC(CCC(C)(C(N)=O)S(C)(=O)=O)CC2)ccc1C#CCC(C)C |
| InChI | InChI=1S/C25H35NO3S/c1-18(2)7-6-8-21-13-14-23(17-19(21)3)22-11-9-20(10-12-22)15-16-25(4,24(26)27)30(5,28)29/h11,13-14,17-18,20H,7,9-10,12,15-16H2,1-5H3,(H2,26,27) |
| InChIKey | VYWRCNRTQSHREL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.63 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|