C13H13N7O — CID 153159221
5-methanimidoyl-4-N-(6-methoxy-1H-indazol-5-yl)pyrimidine-4,6-diamine (PubChem CID 153159221) has the molecular formula C13H13N7O and a molecular weight of 283.30 g/mol. Its IUPAC name is 5-methanimidoyl-4-N-(6-methoxy-1H-indazol-5-yl)pyrimidine-4,6-diamine.
| Compound Name | 5-methanimidoyl-4-N-(6-methoxy-1H-indazol-5-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 153159221 |
| Molecular Formula | C13H13N7O |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 5-methanimidoyl-4-N-(6-methoxy-1H-indazol-5-yl)pyrimidine-4,6-diamine |
| SMILES | [H]/N=C/c1c(N)ncnc1Nc1cc2cn[nH]c2cc1OC |
| InChI | InChI=1S/C13H13N7O/c1-21-11-3-9-7(5-18-20-9)2-10(11)19-13-8(4-14)12(15)16-6-17-13/h2-6,14H,1H3,(H,18,20)(H3,15,16,17,19)/b14-4+ |
| InChIKey | WCADPGCVDJRANX-LNKIKWGQSA-N |
| XLogP | 1.68 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|