C8H11N3 — CID 15316149
(1E,3Z)-2-azidocycloocta-1,3-diene (PubChem CID 15316149) has the molecular formula C8H11N3 and a molecular weight of 149.20 g/mol. Its IUPAC name is (1E,3Z)-2-azidocycloocta-1,3-diene.
| Compound Name | (1E,3Z)-2-azidocycloocta-1,3-diene |
|---|---|
| PubChem CID | 15316149 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | (1E,3Z)-2-azidocycloocta-1,3-diene |
| SMILES | [N-]=[N+]=NC1=C/CCCC/C=C\1 |
| InChI | InChI=1S/C8H11N3/c9-11-10-8-6-4-2-1-3-5-7-8/h4,6-7H,1-3,5H2/b6-4-,8-7+ |
| InChIKey | DBMUNYPDIMSLPH-IQTBQJLQSA-N |
| XLogP | 3.31 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|