C21H20FN5O — CID 15316996
N-[(E)-[1-(4-fluorophenyl)-6,6-dimethyl-5,7-dihydroindazol-4-ylidene]amino]pyridine-4-carboxamide (PubChem CID 15316996) has the molecular formula C21H20FN5O and a molecular weight of 377.42 g/mol. Its IUPAC name is N-[(E)-[1-(4-fluorophenyl)-6,6-dimethyl-5,7-dihydroindazol-4-ylidene]amino]pyridine-4-carboxamide.
| Compound Name | N-[(E)-[1-(4-fluorophenyl)-6,6-dimethyl-5,7-dihydroindazol-4-ylidene]amino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 15316996 |
| Molecular Formula | C21H20FN5O |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-[(E)-[1-(4-fluorophenyl)-6,6-dimethyl-5,7-dihydroindazol-4-ylidene]amino]pyridine-4-carboxamide |
| SMILES | CC1(C)C/C(=N\NC(=O)c2ccncc2)c2cnn(-c3ccc(F)cc3)c2C1 |
| InChI | InChI=1S/C21H20FN5O/c1-21(2)11-18(25-26-20(28)14-7-9-23-10-8-14)17-13-24-27(19(17)12-21)16-5-3-15(22)4-6-16/h3-10,13H,11-12H2,1-2H3,(H,26,28)/b25-18+ |
| InChIKey | ABEQPNDOWFPBHT-XIEYBQDHSA-N |
| XLogP | 3.51 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|