C18H16I2N3O2- — CID 153179179
(2S)-2-(iodoiodanuidylamino)-N-[4-(1,3-oxazol-5-yl)phenyl]-3-phenylpropanamide (PubChem CID 153179179) has the molecular formula C18H16I2N3O2- and a molecular weight of 560.15 g/mol. Its IUPAC name is (2S)-2-(iodoiodanuidylamino)-N-[4-(1,3-oxazol-5-yl)phenyl]-3-phenylpropanamide.
| Compound Name | (2S)-2-(iodoiodanuidylamino)-N-[4-(1,3-oxazol-5-yl)phenyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 153179179 |
| Molecular Formula | C18H16I2N3O2- |
| Molecular Weight | 560.15 g/mol |
| Exact Mass | 559.93 |
| IUPAC Name | (2S)-2-(iodoiodanuidylamino)-N-[4-(1,3-oxazol-5-yl)phenyl]-3-phenylpropanamide |
| SMILES | O=C(Nc1ccc(-c2cnco2)cc1)[C@H](Cc1ccccc1)N[I-]I |
| InChI | InChI=1S/C18H16I2N3O2/c19-20-23-16(10-13-4-2-1-3-5-13)18(24)22-15-8-6-14(7-9-15)17-11-21-12-25-17/h1-9,11-12,16,23H,10H2,(H,22,24)/q-1/t16-/m0/s1 |
| InChIKey | FWPZBBCCFMFWCJ-INIZCTEOSA-N |
| XLogP | 0.83 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.15 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|