C28H25ClN6O2 — CID 153183924
4-(4-chloroanilino)-3-[3-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-3-yl]anilino]cyclopent-3-ene-1,2-dione (PubChem CID 153183924) has the molecular formula C28H25ClN6O2 and a molecular weight of 513.00 g/mol. Its IUPAC name is 4-(4-chloroanilino)-3-[3-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-3-yl]anilino]cyclopent-3-ene-1,2-dione.
| Compound Name | 4-(4-chloroanilino)-3-[3-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-3-yl]anilino]cyclopent-3-ene-1,2-dione |
|---|---|
| PubChem CID | 153183924 |
| Molecular Formula | C28H25ClN6O2 |
| Molecular Weight | 513.00 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | 4-(4-chloroanilino)-3-[3-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-3-yl]anilino]cyclopent-3-ene-1,2-dione |
| SMILES | O=C1CC(Nc2ccc(Cl)cc2)=C(Nc2cccc(C3CCCN(c4ncnc5[nH]ccc45)C3)c2)C1=O |
| InChI | InChI=1S/C28H25ClN6O2/c29-19-6-8-20(9-7-19)33-23-14-24(36)26(37)25(23)34-21-5-1-3-17(13-21)18-4-2-12-35(15-18)28-22-10-11-30-27(22)31-16-32-28/h1,3,5-11,13,16,18,33-34H,2,4,12,14-15H2,(H,30,31,32) |
| InChIKey | WGRYEASSBVEYHR-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.00 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|