About 3-fluoro-3,4-dihydropyridin-6-amine
3-fluoro-3,4-dihydropyridin-6-amine (PubChem CID 153184439) has the molecular formula C5H7FN2
and a molecular weight of 114.12 g/mol. Its IUPAC name is 3-fluoro-3,4-dihydropyridin-6-amine.
Molecular Properties
| Compound Name | 3-fluoro-3,4-dihydropyridin-6-amine |
| PubChem CID | 153184439 |
| Molecular Formula | C5H7FN2 |
| Molecular Weight | 114.12 g/mol |
| Exact Mass | 114.06 |
| IUPAC Name | 3-fluoro-3,4-dihydropyridin-6-amine |
| SMILES | NC1=CCC(F)C=N1 |
| InChI | InChI=1S/C5H7FN2/c6-4-1-2-5(7)8-3-4/h2-4H,1,7H2 |
| InChIKey | WGUOPUWFGYPMIS-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.12 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-fluoro-3,4-dihydropyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-3,4-dihydropyridin-6-amine?
The IUPAC name of 3-fluoro-3,4-dihydropyridin-6-amine (CID 153184439) is 3-fluoro-3,4-dihydropyridin-6-amine.
What is the SMILES notation for 3-fluoro-3,4-dihydropyridin-6-amine?
The canonical SMILES for 3-fluoro-3,4-dihydropyridin-6-amine is NC1=CCC(F)C=N1.
What is the InChIKey of 3-fluoro-3,4-dihydropyridin-6-amine?
The InChIKey is WGUOPUWFGYPMIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7FN2/c6-4-1-2-5(7)8-3-4/h2-4H,1,7H2.
What are the key properties of 3-fluoro-3,4-dihydropyridin-6-amine?
3-fluoro-3,4-dihydropyridin-6-amine has a molecular weight of 114.12 g/mol, XLogP of 0.60, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-3,4-dihydropyridin-6-amine is sourced from PubChem (CID 153184439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).