About N-(3-fluoro-3,4-dihydropyridin-6-yl)methanimine
N-(3-fluoro-3,4-dihydropyridin-6-yl)methanimine (PubChem CID 91428814) has the molecular formula C6H7FN2
and a molecular weight of 126.13 g/mol. Its IUPAC name is N-(3-fluoro-3,4-dihydropyridin-6-yl)methanimine.
Molecular Properties
| Compound Name | N-(3-fluoro-3,4-dihydropyridin-6-yl)methanimine |
| PubChem CID | 91428814 |
| Molecular Formula | C6H7FN2 |
| Molecular Weight | 126.13 g/mol |
| Exact Mass | 126.06 |
| IUPAC Name | N-(3-fluoro-3,4-dihydropyridin-6-yl)methanimine |
| SMILES | C=NC1=CCC(F)C=N1 |
| InChI | InChI=1S/C6H7FN2/c1-8-6-3-2-5(7)4-9-6/h3-5H,1-2H2 |
| InChIKey | BDQVDUUOKSWKBX-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.13 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(3-fluoro-3,4-dihydropyridin-6-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-fluoro-3,4-dihydropyridin-6-yl)methanimine?
The IUPAC name of N-(3-fluoro-3,4-dihydropyridin-6-yl)methanimine (CID 91428814) is N-(3-fluoro-3,4-dihydropyridin-6-yl)methanimine.
What is the SMILES notation for N-(3-fluoro-3,4-dihydropyridin-6-yl)methanimine?
The canonical SMILES for N-(3-fluoro-3,4-dihydropyridin-6-yl)methanimine is C=NC1=CCC(F)C=N1.
What is the InChIKey of N-(3-fluoro-3,4-dihydropyridin-6-yl)methanimine?
The InChIKey is BDQVDUUOKSWKBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7FN2/c1-8-6-3-2-5(7)4-9-6/h3-5H,1-2H2.
What are the key properties of N-(3-fluoro-3,4-dihydropyridin-6-yl)methanimine?
N-(3-fluoro-3,4-dihydropyridin-6-yl)methanimine has a molecular weight of 126.13 g/mol, XLogP of 1.34, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-fluoro-3,4-dihydropyridin-6-yl)methanimine is sourced from PubChem (CID 91428814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).