C16H17N3O5 — CID 153189612
2-[3-(2-morpholin-4-yl-2-oxoethyl)-4-oxophthalazin-1-yl]acetic acid (PubChem CID 153189612) has the molecular formula C16H17N3O5 and a molecular weight of 331.33 g/mol. Its IUPAC name is 2-[3-(2-morpholin-4-yl-2-oxoethyl)-4-oxophthalazin-1-yl]acetic acid.
| Compound Name | 2-[3-(2-morpholin-4-yl-2-oxoethyl)-4-oxophthalazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 153189612 |
| Molecular Formula | C16H17N3O5 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 2-[3-(2-morpholin-4-yl-2-oxoethyl)-4-oxophthalazin-1-yl]acetic acid |
| SMILES | O=C(O)Cc1nn(CC(=O)N2CCOCC2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C16H17N3O5/c20-14(18-5-7-24-8-6-18)10-19-16(23)12-4-2-1-3-11(12)13(17-19)9-15(21)22/h1-4H,5-10H2,(H,21,22) |
| InChIKey | WHTXOPVACLPBIE-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |