C33H30FNO4S2 — CID 153189785
5-[3-fluoro-4-[2-[5-(4-methoxybutyl)furan-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-phenyl-4-sulfanylidenepentan-2-one (PubChem CID 153189785) has the molecular formula C33H30FNO4S2 and a molecular weight of 587.74 g/mol. Its IUPAC name is 5-[3-fluoro-4-[2-[5-(4-methoxybutyl)furan-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-phenyl-4-sulfanylidenepentan-2-one.
| Compound Name | 5-[3-fluoro-4-[2-[5-(4-methoxybutyl)furan-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-phenyl-4-sulfanylidenepentan-2-one |
|---|---|
| PubChem CID | 153189785 |
| Molecular Formula | C33H30FNO4S2 |
| Molecular Weight | 587.74 g/mol |
| Exact Mass | 587.16 |
| IUPAC Name | 5-[3-fluoro-4-[2-[5-(4-methoxybutyl)furan-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-phenyl-4-sulfanylidenepentan-2-one |
| SMILES | COCCCCc1ccc(-c2cc3nccc(Oc4ccc(CC(=S)CC(=O)Cc5ccccc5)cc4F)c3s2)o1 |
| InChI | InChI=1S/C33H30FNO4S2/c1-37-16-6-5-9-25-11-13-30(38-25)32-21-28-33(41-32)31(14-15-35-28)39-29-12-10-23(19-27(29)34)18-26(40)20-24(36)17-22-7-3-2-4-8-22/h2-4,7-8,10-15,19,21H,5-6,9,16-18,20H2,1H3 |
| InChIKey | WHUUVPXMEPCBSD-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.74 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|