C20H14N4OS2 — CID 15319434
13-ethylsulfanyl-14-phenyl-17-thia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12-heptaen-15-one (PubChem CID 15319434) has the molecular formula C20H14N4OS2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 13-ethylsulfanyl-14-phenyl-17-thia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12-heptaen-15-one.
| Compound Name | 13-ethylsulfanyl-14-phenyl-17-thia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12-heptaen-15-one |
|---|---|
| PubChem CID | 15319434 |
| Molecular Formula | C20H14N4OS2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 13-ethylsulfanyl-14-phenyl-17-thia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12-heptaen-15-one |
| SMILES | CCSc1nc2c(sc3nc4ccccc4nc32)c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C20H14N4OS2/c1-2-26-20-23-15-16-18(22-14-11-7-6-10-13(14)21-16)27-17(15)19(25)24(20)12-8-4-3-5-9-12/h3-11H,2H2,1H3 |
| InChIKey | UQJIIKCTXIKWDQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |