C17H23NO3S — CID 15320266
(2S,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-hydroxy-2,4-dimethylpentan-1-one (PubChem CID 15320266) has the molecular formula C17H23NO3S and a molecular weight of 321.44 g/mol. Its IUPAC name is (2S,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-hydroxy-2,4-dimethylpentan-1-one.
| Compound Name | (2S,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-hydroxy-2,4-dimethylpentan-1-one |
|---|---|
| PubChem CID | 15320266 |
| Molecular Formula | C17H23NO3S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | (2S,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-hydroxy-2,4-dimethylpentan-1-one |
| SMILES | CC(C)[C@@H](O)[C@H](C)C(=O)N1C(=S)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C17H23NO3S/c1-11(2)15(19)12(3)16(20)18-14(10-21-17(18)22)9-13-7-5-4-6-8-13/h4-8,11-12,14-15,19H,9-10H2,1-3H3/t12-,14-,15+/m0/s1 |
| InChIKey | XBEJTAVCKNXXTD-AEGPPILISA-N |
| XLogP | 2.39 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|