C17H18N4O2 — CID 153203644
1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-(3-phenyloxiran-2-yl)pyrazol-4-amine (PubChem CID 153203644) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-(3-phenyloxiran-2-yl)pyrazol-4-amine.
| Compound Name | 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-(3-phenyloxiran-2-yl)pyrazol-4-amine |
|---|---|
| PubChem CID | 153203644 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-(3-phenyloxiran-2-yl)pyrazol-4-amine |
| SMILES | Cc1noc(C)c1Cn1cc(NC2OC2c2ccccc2)cn1 |
| InChI | InChI=1S/C17H18N4O2/c1-11-15(12(2)23-20-11)10-21-9-14(8-18-21)19-17-16(22-17)13-6-4-3-5-7-13/h3-9,16-17,19H,10H2,1-2H3 |
| InChIKey | WKJWFDPXHPQIMK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 68.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|