C21H20F3N3O2 — CID 153208348
N-(3-imidazol-1-ylpropyl)-4-[[4-(trifluoromethoxy)phenyl]methyl]benzamide (PubChem CID 153208348) has the molecular formula C21H20F3N3O2 and a molecular weight of 403.40 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-4-[[4-(trifluoromethoxy)phenyl]methyl]benzamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-4-[[4-(trifluoromethoxy)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 153208348 |
| Molecular Formula | C21H20F3N3O2 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-4-[[4-(trifluoromethoxy)phenyl]methyl]benzamide |
| SMILES | O=C(NCCCn1ccnc1)c1ccc(Cc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H20F3N3O2/c22-21(23,24)29-19-8-4-17(5-9-19)14-16-2-6-18(7-3-16)20(28)26-10-1-12-27-13-11-25-15-27/h2-9,11,13,15H,1,10,12,14H2,(H,26,28) |
| InChIKey | WLGXVJLCDCPPGX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|