C25H25N5O — CID 153216779
2-(5-methyl-1H-indazol-4-yl)-4-(2-prop-2-enoyl-2,7-diazaspiro[3.5]nonan-7-yl)benzonitrile (PubChem CID 153216779) has the molecular formula C25H25N5O and a molecular weight of 411.51 g/mol. Its IUPAC name is 2-(5-methyl-1H-indazol-4-yl)-4-(2-prop-2-enoyl-2,7-diazaspiro[3.5]nonan-7-yl)benzonitrile.
| Compound Name | 2-(5-methyl-1H-indazol-4-yl)-4-(2-prop-2-enoyl-2,7-diazaspiro[3.5]nonan-7-yl)benzonitrile |
|---|---|
| PubChem CID | 153216779 |
| Molecular Formula | C25H25N5O |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 2-(5-methyl-1H-indazol-4-yl)-4-(2-prop-2-enoyl-2,7-diazaspiro[3.5]nonan-7-yl)benzonitrile |
| SMILES | C=CC(=O)N1CC2(CCN(c3ccc(C#N)c(-c4c(C)ccc5[nH]ncc45)c3)CC2)C1 |
| InChI | InChI=1S/C25H25N5O/c1-3-23(31)30-15-25(16-30)8-10-29(11-9-25)19-6-5-18(13-26)20(12-19)24-17(2)4-7-22-21(24)14-27-28-22/h3-7,12,14H,1,8-11,15-16H2,2H3,(H,27,28) |
| InChIKey | WMWDGDQOSXSGDZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|