C27H26N6O — CID 170548516
(2R,4S)-10-(5-methyl-1H-indazol-4-yl)-8-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-7-azatricyclo[4.4.0.02,4]deca-1(6),7,9-triene-9-carbonitrile (PubChem CID 170548516) has the molecular formula C27H26N6O and a molecular weight of 450.55 g/mol. Its IUPAC name is (2R,4S)-10-(5-methyl-1H-indazol-4-yl)-8-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-7-azatricyclo[4.4.0.02,4]deca-1(6),7,9-triene-9-carbonitrile.
| Compound Name | (2R,4S)-10-(5-methyl-1H-indazol-4-yl)-8-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-7-azatricyclo[4.4.0.02,4]deca-1(6),7,9-triene-9-carbonitrile |
|---|---|
| PubChem CID | 170548516 |
| Molecular Formula | C27H26N6O |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | (2R,4S)-10-(5-methyl-1H-indazol-4-yl)-8-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-7-azatricyclo[4.4.0.02,4]deca-1(6),7,9-triene-9-carbonitrile |
| SMILES | C=CC(=O)N1CC2(CCN(c3nc4c(c(-c5c(C)ccc6[nH]ncc56)c3C#N)[C@@H]3C[C@H]3C4)C2)C1 |
| InChI | InChI=1S/C27H26N6O/c1-3-22(34)33-13-27(14-33)6-7-32(12-27)26-18(10-28)25(24-17-8-16(17)9-21(24)30-26)23-15(2)4-5-20-19(23)11-29-31-20/h3-5,11,16-17H,1,6-9,12-14H2,2H3,(H,29,31)/t16-,17+/m0/s1 |
| InChIKey | BJXGBJKKVCLAGI-DLBZAZTESA-N |
| XLogP | 3.69 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|