C29H30N6O — CID 167037290
(1S,8R)-6-(1,6-dimethylindazol-7-yl)-4-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-5-carbonitrile (PubChem CID 167037290) has the molecular formula C29H30N6O and a molecular weight of 478.60 g/mol. Its IUPAC name is (1S,8R)-6-(1,6-dimethylindazol-7-yl)-4-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-5-carbonitrile.
| Compound Name | (1S,8R)-6-(1,6-dimethylindazol-7-yl)-4-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-5-carbonitrile |
|---|---|
| PubChem CID | 167037290 |
| Molecular Formula | C29H30N6O |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | (1S,8R)-6-(1,6-dimethylindazol-7-yl)-4-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-5-carbonitrile |
| SMILES | C=CC(=O)N1CC2(CCN(c3nc4c(c(-c5c(C)ccc6cnn(C)c56)c3C#N)[C@@H]3CC[C@H]4C3)C2)C1 |
| InChI | InChI=1S/C29H30N6O/c1-4-22(36)35-15-29(16-35)9-10-34(14-29)28-21(12-30)25(24-18-7-8-19(11-18)26(24)32-28)23-17(2)5-6-20-13-31-33(3)27(20)23/h4-6,13,18-19H,1,7-11,14-16H2,2-3H3/t18-,19+/m1/s1 |
| InChIKey | MMVMTMRRANLFRM-MOPGFXCFSA-N |
| XLogP | 4.40 |
| TPSA | 78.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|