C30H32N6O2 — CID 170548552
(1aS,7bR)-4-(1,6-dimethylindazol-7-yl)-6-[(5R)-5-(hydroxymethyl)-2-prop-2-enoyl-2,6-diazaspiro[3.4]octan-6-yl]-1a,2,3,7b-tetrahydro-1H-cyclopropa[h]quinoline-5-carbonitrile (PubChem CID 170548552) has the molecular formula C30H32N6O2 and a molecular weight of 508.63 g/mol. Its IUPAC name is (1aS,7bR)-4-(1,6-dimethylindazol-7-yl)-6-[(5R)-5-(hydroxymethyl)-2-prop-2-enoyl-2,6-diazaspiro[3.4]octan-6-yl]-1a,2,3,7b-tetrahydro-1H-cyclopropa[h]quinoline-5-carbonitrile.
| Compound Name | (1aS,7bR)-4-(1,6-dimethylindazol-7-yl)-6-[(5R)-5-(hydroxymethyl)-2-prop-2-enoyl-2,6-diazaspiro[3.4]octan-6-yl]-1a,2,3,7b-tetrahydro-1H-cyclopropa[h]quinoline-5-carbonitrile |
|---|---|
| PubChem CID | 170548552 |
| Molecular Formula | C30H32N6O2 |
| Molecular Weight | 508.63 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | (1aS,7bR)-4-(1,6-dimethylindazol-7-yl)-6-[(5R)-5-(hydroxymethyl)-2-prop-2-enoyl-2,6-diazaspiro[3.4]octan-6-yl]-1a,2,3,7b-tetrahydro-1H-cyclopropa[h]quinoline-5-carbonitrile |
| SMILES | C=CC(=O)N1CC2(CCN(c3nc4c(c(-c5c(C)ccc6cnn(C)c56)c3C#N)CC[C@H]3C[C@@H]43)[C@H]2CO)C1 |
| InChI | InChI=1S/C30H32N6O2/c1-4-24(38)35-15-30(16-35)9-10-36(23(30)14-37)29-22(12-31)26(20-8-7-18-11-21(18)27(20)33-29)25-17(2)5-6-19-13-32-34(3)28(19)25/h4-6,13,18,21,23,37H,1,7-11,14-16H2,2-3H3/t18-,21+,23-/m0/s1 |
| InChIKey | XGOJUBGOEZRDRD-ZEYPLWLESA-N |
| XLogP | 3.45 |
| TPSA | 98.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.63 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|