C29H28N6O — CID 167037710
2-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-4-(1,5,6-trimethylindazol-7-yl)quinoline-3-carbonitrile (PubChem CID 167037710) has the molecular formula C29H28N6O and a molecular weight of 476.58 g/mol. Its IUPAC name is 2-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-4-(1,5,6-trimethylindazol-7-yl)quinoline-3-carbonitrile.
| Compound Name | 2-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-4-(1,5,6-trimethylindazol-7-yl)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 167037710 |
| Molecular Formula | C29H28N6O |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 2-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-4-(1,5,6-trimethylindazol-7-yl)quinoline-3-carbonitrile |
| SMILES | C=CC(=O)N1CC2(CCN(c3nc4ccccc4c(-c4c(C)c(C)cc5cnn(C)c45)c3C#N)C2)C1 |
| InChI | InChI=1S/C29H28N6O/c1-5-24(36)35-16-29(17-35)10-11-34(15-29)28-22(13-30)26(21-8-6-7-9-23(21)32-28)25-19(3)18(2)12-20-14-31-33(4)27(20)25/h5-9,12,14H,1,10-11,15-17H2,2-4H3 |
| InChIKey | WOUPDWVJFJVBNY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 78.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|