C27H29N7OS — CID 170925789
(7R)-7-(2-methylpyrazol-3-yl)-4-(4-methyl-1,3-thiazol-5-yl)-2-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-5,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 170925789) has the molecular formula C27H29N7OS and a molecular weight of 499.64 g/mol. Its IUPAC name is (7R)-7-(2-methylpyrazol-3-yl)-4-(4-methyl-1,3-thiazol-5-yl)-2-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-5,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | (7R)-7-(2-methylpyrazol-3-yl)-4-(4-methyl-1,3-thiazol-5-yl)-2-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 170925789 |
| Molecular Formula | C27H29N7OS |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | (7R)-7-(2-methylpyrazol-3-yl)-4-(4-methyl-1,3-thiazol-5-yl)-2-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | C=CC(=O)N1CC2(CCN(c3nc4c(c(-c5scnc5C)c3C#N)CC[C@@H](c3ccnn3C)C4)C2)C1 |
| InChI | InChI=1S/C27H29N7OS/c1-4-23(35)34-14-27(15-34)8-10-33(13-27)26-20(12-28)24(25-17(2)29-16-36-25)19-6-5-18(11-21(19)31-26)22-7-9-30-32(22)3/h4,7,9,16,18H,1,5-6,8,10-11,13-15H2,2-3H3/t18-/m1/s1 |
| InChIKey | GNCPLTZLOQRJGL-GOSISDBHSA-N |
| XLogP | 3.62 |
| TPSA | 90.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|