C28H30N6O — CID 167037505
(1R,8S)-4-[2-(1-hydroxyprop-2-enyl)-2,7-diazaspiro[3.4]octan-7-yl]-6-(5-methyl-1H-indazol-4-yl)-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-5-carbonitrile (PubChem CID 167037505) has the molecular formula C28H30N6O and a molecular weight of 466.59 g/mol. Its IUPAC name is (1R,8S)-4-[2-(1-hydroxyprop-2-enyl)-2,7-diazaspiro[3.4]octan-7-yl]-6-(5-methyl-1H-indazol-4-yl)-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-5-carbonitrile.
| Compound Name | (1R,8S)-4-[2-(1-hydroxyprop-2-enyl)-2,7-diazaspiro[3.4]octan-7-yl]-6-(5-methyl-1H-indazol-4-yl)-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-5-carbonitrile |
|---|---|
| PubChem CID | 167037505 |
| Molecular Formula | C28H30N6O |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | (1R,8S)-4-[2-(1-hydroxyprop-2-enyl)-2,7-diazaspiro[3.4]octan-7-yl]-6-(5-methyl-1H-indazol-4-yl)-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-5-carbonitrile |
| SMILES | C=CC(O)N1CC2(CCN(c3nc4c(c(-c5c(C)ccc6[nH]ncc56)c3C#N)[C@H]3CC[C@@H]4C3)C2)C1 |
| InChI | InChI=1S/C28H30N6O/c1-3-22(35)34-14-28(15-34)8-9-33(13-28)27-19(11-29)25(24-17-5-6-18(10-17)26(24)31-27)23-16(2)4-7-21-20(23)12-30-32-21/h3-4,7,12,17-18,22,35H,1,5-6,8-10,13-15H2,2H3,(H,30,32)/t17-,18+,22?/m0/s1 |
| InChIKey | DTCDWXUUAWSFRP-WQFBUZOZSA-N |
| XLogP | 4.19 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|