C7H17NO3S — CID 15321978
N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-N-methylmethanesulfonamide (PubChem CID 15321978) has the molecular formula C7H17NO3S and a molecular weight of 195.28 g/mol. Its IUPAC name is N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-N-methylmethanesulfonamide.
| Compound Name | N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 15321978 |
| Molecular Formula | C7H17NO3S |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-N-methylmethanesulfonamide |
| SMILES | CC(C)[C@@H](CO)N(C)S(C)(=O)=O |
| InChI | InChI=1S/C7H17NO3S/c1-6(2)7(5-9)8(3)12(4,10)11/h6-7,9H,5H2,1-4H3/t7-/m1/s1 |
| InChIKey | SNXJPXBHLFSDAO-SSDOTTSWSA-N |
| XLogP | -0.11 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |