C21H25N9OS2 — CID 153237683
N-[5-[[(1R,3S)-3-[5-[[(Z)-1-amino-3-(methylamino)prop-2-enylidene]amino]-1,3,4-thiadiazol-2-yl]cyclopentyl]methyl]-1,3,4-thiadiazol-2-yl]-2-pyridin-2-ylacetamide (PubChem CID 153237683) has the molecular formula C21H25N9OS2 and a molecular weight of 483.63 g/mol. Its IUPAC name is N-[5-[[(1R,3S)-3-[5-[[(Z)-1-amino-3-(methylamino)prop-2-enylidene]amino]-1,3,4-thiadiazol-2-yl]cyclopentyl]methyl]-1,3,4-thiadiazol-2-yl]-2-pyridin-2-ylacetamide.
| Compound Name | N-[5-[[(1R,3S)-3-[5-[[(Z)-1-amino-3-(methylamino)prop-2-enylidene]amino]-1,3,4-thiadiazol-2-yl]cyclopentyl]methyl]-1,3,4-thiadiazol-2-yl]-2-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 153237683 |
| Molecular Formula | C21H25N9OS2 |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | N-[5-[[(1R,3S)-3-[5-[[(Z)-1-amino-3-(methylamino)prop-2-enylidene]amino]-1,3,4-thiadiazol-2-yl]cyclopentyl]methyl]-1,3,4-thiadiazol-2-yl]-2-pyridin-2-ylacetamide |
| SMILES | CN/C=C\C(N)=Nc1nnc([C@H]2CC[C@@H](Cc3nnc(NC(=O)Cc4ccccn4)s3)C2)s1 |
| InChI | InChI=1S/C21H25N9OS2/c1-23-9-7-16(22)25-20-30-28-19(33-20)14-6-5-13(10-14)11-18-27-29-21(32-18)26-17(31)12-15-4-2-3-8-24-15/h2-4,7-9,13-14,23H,5-6,10-12H2,1H3,(H2,22,25,30)(H,26,29,31)/b9-7-/t13-,14+/m1/s1 |
| InChIKey | WQUULWFAOIEQJK-ZAACICEASA-N |
| XLogP | 2.81 |
| TPSA | 143.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|