C26H26N6O2 — CID 153240462
(3S)-1-[4-[[6-(5H-cyclopenta[b]pyridin-3-yl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-methoxyphenyl]piperidin-3-ol (PubChem CID 153240462) has the molecular formula C26H26N6O2 and a molecular weight of 454.53 g/mol. Its IUPAC name is (3S)-1-[4-[[6-(5H-cyclopenta[b]pyridin-3-yl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-methoxyphenyl]piperidin-3-ol.
| Compound Name | (3S)-1-[4-[[6-(5H-cyclopenta[b]pyridin-3-yl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-methoxyphenyl]piperidin-3-ol |
|---|---|
| PubChem CID | 153240462 |
| Molecular Formula | C26H26N6O2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | (3S)-1-[4-[[6-(5H-cyclopenta[b]pyridin-3-yl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-methoxyphenyl]piperidin-3-ol |
| SMILES | COc1cc(Nc2nc(-c3cnc4c(c3)CC=C4)cn3ccnc23)ccc1N1CCC[C@H](O)C1 |
| InChI | InChI=1S/C26H26N6O2/c1-34-24-13-19(7-8-23(24)31-10-3-5-20(33)15-31)29-25-26-27-9-11-32(26)16-22(30-25)18-12-17-4-2-6-21(17)28-14-18/h2,6-9,11-14,16,20,33H,3-5,10,15H2,1H3,(H,29,30)/t20-/m0/s1 |
| InChIKey | WRIPPOLHEJQMAI-FQEVSTJZSA-N |
| XLogP | 4.07 |
| TPSA | 87.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|