C25H24N6O2 — CID 147088426
[(2S)-4-[4-[[6-(5H-cyclopenta[b]pyridin-3-yl)imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]morpholin-2-yl]methanol (PubChem CID 147088426) has the molecular formula C25H24N6O2 and a molecular weight of 440.51 g/mol. Its IUPAC name is [(2S)-4-[4-[[6-(5H-cyclopenta[b]pyridin-3-yl)imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]morpholin-2-yl]methanol.
| Compound Name | [(2S)-4-[4-[[6-(5H-cyclopenta[b]pyridin-3-yl)imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]morpholin-2-yl]methanol |
|---|---|
| PubChem CID | 147088426 |
| Molecular Formula | C25H24N6O2 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | [(2S)-4-[4-[[6-(5H-cyclopenta[b]pyridin-3-yl)imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]morpholin-2-yl]methanol |
| SMILES | OC[C@@H]1CN(c2ccc(Nc3nc(-c4cnc5c(c4)CC=C5)cn4ccnc34)cc2)CCO1 |
| InChI | InChI=1S/C25H24N6O2/c32-16-21-14-30(10-11-33-21)20-6-4-19(5-7-20)28-24-25-26-8-9-31(25)15-23(29-24)18-12-17-2-1-3-22(17)27-13-18/h1,3-9,12-13,15,21,32H,2,10-11,14,16H2,(H,28,29)/t21-/m0/s1 |
| InChIKey | BIHSWCNVJXODND-NRFANRHFSA-N |
| XLogP | 3.30 |
| TPSA | 87.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|