C20H15N5 — CID 153246984
4-N-[3-(2-phenylethynyl)-1H-isoindol-5-yl]pyrimidine-2,4-diamine (PubChem CID 153246984) has the molecular formula C20H15N5 and a molecular weight of 325.38 g/mol. Its IUPAC name is 4-N-[3-(2-phenylethynyl)-1H-isoindol-5-yl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[3-(2-phenylethynyl)-1H-isoindol-5-yl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 153246984 |
| Molecular Formula | C20H15N5 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 4-N-[3-(2-phenylethynyl)-1H-isoindol-5-yl]pyrimidine-2,4-diamine |
| SMILES | Nc1nccc(Nc2ccc3c(c2)C(C#Cc2ccccc2)=NC3)n1 |
| InChI | InChI=1S/C20H15N5/c21-20-22-11-10-19(25-20)24-16-8-7-15-13-23-18(17(15)12-16)9-6-14-4-2-1-3-5-14/h1-5,7-8,10-12H,13H2,(H3,21,22,24,25) |
| InChIKey | WSOMUHLNFUBSNZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|