C13H24Se2 — CID 15325789
(1Z)-1,2-bis(butylselanyl)penta-1,4-diene (PubChem CID 15325789) has the molecular formula C13H24Se2 and a molecular weight of 338.26 g/mol. Its IUPAC name is (1Z)-1,2-bis(butylselanyl)penta-1,4-diene.
| Compound Name | (1Z)-1,2-bis(butylselanyl)penta-1,4-diene |
|---|---|
| PubChem CID | 15325789 |
| Molecular Formula | C13H24Se2 |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | (1Z)-1,2-bis(butylselanyl)penta-1,4-diene |
| SMILES | C=CC/C(=C/[Se]CCCC)[Se]CCCC |
| InChI | InChI=1S/C13H24Se2/c1-4-7-10-14-12-13(9-6-3)15-11-8-5-2/h6,12H,3-5,7-11H2,1-2H3/b13-12- |
| InChIKey | OBZYVAVIJZLAOZ-SEYXRHQNSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|