C37H38N2Si2 — CID 153260789
trimethyl-[2-methyl-8-(5-trimethylsilyl-6H-indeno[2,1-b]indol-3-yl)-6H-indeno[2,1-b]indol-5-yl]silane (PubChem CID 153260789) has the molecular formula C37H38N2Si2 and a molecular weight of 566.90 g/mol. Its IUPAC name is trimethyl-[2-methyl-8-(5-trimethylsilyl-6H-indeno[2,1-b]indol-3-yl)-6H-indeno[2,1-b]indol-5-yl]silane.
| Compound Name | trimethyl-[2-methyl-8-(5-trimethylsilyl-6H-indeno[2,1-b]indol-3-yl)-6H-indeno[2,1-b]indol-5-yl]silane |
|---|---|
| PubChem CID | 153260789 |
| Molecular Formula | C37H38N2Si2 |
| Molecular Weight | 566.90 g/mol |
| Exact Mass | 566.26 |
| IUPAC Name | trimethyl-[2-methyl-8-(5-trimethylsilyl-6H-indeno[2,1-b]indol-3-yl)-6H-indeno[2,1-b]indol-5-yl]silane |
| SMILES | Cc1ccc2c(c1)c1c(n2[Si](C)(C)C)Cc2cc(-c3ccc4c5c(n([Si](C)(C)C)c4c3)Cc3ccccc3-5)ccc2-1 |
| InChI | InChI=1S/C37H38N2Si2/c1-23-12-17-32-31(18-23)37-29-15-13-24(19-27(29)22-35(37)38(32)40(2,3)4)25-14-16-30-33(20-25)39(41(5,6)7)34-21-26-10-8-9-11-28(26)36(30)34/h8-20H,21-22H2,1-7H3 |
| InChIKey | WVEQILSJEBYFCW-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.90 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|