C8H16O2 — CID 15326198
(2S,3R)-2-butyl-3-(methoxymethyl)oxirane (PubChem CID 15326198) has the molecular formula C8H16O2 and a molecular weight of 144.21 g/mol. Its IUPAC name is (2S,3R)-2-butyl-3-(methoxymethyl)oxirane.
| Compound Name | (2S,3R)-2-butyl-3-(methoxymethyl)oxirane |
|---|---|
| PubChem CID | 15326198 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | (2S,3R)-2-butyl-3-(methoxymethyl)oxirane |
| SMILES | CCCC[C@@H]1O[C@@H]1COC |
| InChI | InChI=1S/C8H16O2/c1-3-4-5-7-8(10-7)6-9-2/h7-8H,3-6H2,1-2H3/t7-,8+/m0/s1 |
| InChIKey | JVSUGQBKSQCLAH-JGVFFNPUSA-N |
| XLogP | 1.59 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|