C15H14N4O3S — CID 153263017
2-[[5-[1-(2-amino-2-oxoethyl)indol-3-yl]-4H-pyrazol-3-yl]sulfanyl]acetic acid (PubChem CID 153263017) has the molecular formula C15H14N4O3S and a molecular weight of 330.37 g/mol. Its IUPAC name is 2-[[5-[1-(2-amino-2-oxoethyl)indol-3-yl]-4H-pyrazol-3-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-[1-(2-amino-2-oxoethyl)indol-3-yl]-4H-pyrazol-3-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 153263017 |
| Molecular Formula | C15H14N4O3S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 2-[[5-[1-(2-amino-2-oxoethyl)indol-3-yl]-4H-pyrazol-3-yl]sulfanyl]acetic acid |
| SMILES | NC(=O)Cn1cc(C2=NN=C(SCC(=O)O)C2)c2ccccc21 |
| InChI | InChI=1S/C15H14N4O3S/c16-13(20)7-19-6-10(9-3-1-2-4-12(9)19)11-5-14(18-17-11)23-8-15(21)22/h1-4,6H,5,7-8H2,(H2,16,20)(H,21,22) |
| InChIKey | WVPRSHFBJAUZBJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 110.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |