C33H23BN2O2 — CID 153263417
6-[(2E,3Z)-3-ethylidene-2-prop-2-enylideneindol-1-yl]-9,24-dioxa-2-aza-10-borahexacyclo[15.7.0.02,10.03,8.011,16.018,23]tetracosa-1(17),3(8),4,6,11,13,15,18,20,22-decaene (PubChem CID 153263417) has the molecular formula C33H23BN2O2 and a molecular weight of 490.37 g/mol. Its IUPAC name is 6-[(2E,3Z)-3-ethylidene-2-prop-2-enylideneindol-1-yl]-9,24-dioxa-2-aza-10-borahexacyclo[15.7.0.02,10.03,8.011,16.018,23]tetracosa-1(17),3(8),4,6,11,13,15,18,20,22-decaene.
| Compound Name | 6-[(2E,3Z)-3-ethylidene-2-prop-2-enylideneindol-1-yl]-9,24-dioxa-2-aza-10-borahexacyclo[15.7.0.02,10.03,8.011,16.018,23]tetracosa-1(17),3(8),4,6,11,13,15,18,20,22-decaene |
|---|---|
| PubChem CID | 153263417 |
| Molecular Formula | C33H23BN2O2 |
| Molecular Weight | 490.37 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 6-[(2E,3Z)-3-ethylidene-2-prop-2-enylideneindol-1-yl]-9,24-dioxa-2-aza-10-borahexacyclo[15.7.0.02,10.03,8.011,16.018,23]tetracosa-1(17),3(8),4,6,11,13,15,18,20,22-decaene |
| SMILES | C=C/C=c1\c(=C/C)c2ccccc2n1-c1ccc2c(c1)OB1c3ccccc3-c3c(oc4ccccc34)N12 |
| InChI | InChI=1S/C33H23BN2O2/c1-3-11-27-22(4-2)23-12-6-9-16-28(23)35(27)21-18-19-29-31(20-21)38-34-26-15-8-5-13-24(26)32-25-14-7-10-17-30(25)37-33(32)36(29)34/h3-20H,1H2,2H3/b22-4-,27-11+ |
| InChIKey | WVRQRHBRWLVSSZ-HNLOTFKMSA-N |
| XLogP | 6.05 |
| TPSA | 30.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.37 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|