C20H24BNO2 — CID 143305921
[3-[(2E,3Z)-2,3-di(ethylidene)indol-1-yl]phenyl]boronic acid;ethane (PubChem CID 143305921) has the molecular formula C20H24BNO2 and a molecular weight of 321.23 g/mol. Its IUPAC name is [3-[(2E,3Z)-2,3-di(ethylidene)indol-1-yl]phenyl]boronic acid;ethane.
| Compound Name | [3-[(2E,3Z)-2,3-di(ethylidene)indol-1-yl]phenyl]boronic acid;ethane |
|---|---|
| PubChem CID | 143305921 |
| Molecular Formula | C20H24BNO2 |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | [3-[(2E,3Z)-2,3-di(ethylidene)indol-1-yl]phenyl]boronic acid;ethane |
| SMILES | C/C=c1\c(=C/C)n(-c2cccc(B(O)O)c2)c2ccccc12.CC |
| InChI | InChI=1S/C18H18BNO2.C2H6/c1-3-15-16-10-5-6-11-18(16)20(17(15)4-2)14-9-7-8-13(12-14)19(21)22;1-2/h3-12,21-22H,1-2H3;1-2H3/b15-3-,17-4+; |
| InChIKey | ICDLEYNGWGZUAT-BQVCJOJRSA-N |
| XLogP | 1.94 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|