C23H25F5N6O — CID 153264876
2-amino-1-[5,5-difluoro-3-methyl-2-[[[5-(trifluoromethyl)pyrimidin-2-yl]amino]methyl]piperidin-1-yl]-4-methylimino-3-phenylbut-2-en-1-one (PubChem CID 153264876) has the molecular formula C23H25F5N6O and a molecular weight of 496.48 g/mol. Its IUPAC name is 2-amino-1-[5,5-difluoro-3-methyl-2-[[[5-(trifluoromethyl)pyrimidin-2-yl]amino]methyl]piperidin-1-yl]-4-methylimino-3-phenylbut-2-en-1-one.
| Compound Name | 2-amino-1-[5,5-difluoro-3-methyl-2-[[[5-(trifluoromethyl)pyrimidin-2-yl]amino]methyl]piperidin-1-yl]-4-methylimino-3-phenylbut-2-en-1-one |
|---|---|
| PubChem CID | 153264876 |
| Molecular Formula | C23H25F5N6O |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | 2-amino-1-[5,5-difluoro-3-methyl-2-[[[5-(trifluoromethyl)pyrimidin-2-yl]amino]methyl]piperidin-1-yl]-4-methylimino-3-phenylbut-2-en-1-one |
| SMILES | C/N=C/C(=C(N)C(=O)N1CC(F)(F)CC(C)C1CNc1ncc(C(F)(F)F)cn1)c1ccccc1 |
| InChI | InChI=1S/C23H25F5N6O/c1-14-8-22(24,25)13-34(18(14)12-33-21-31-9-16(10-32-21)23(26,27)28)20(35)19(29)17(11-30-2)15-6-4-3-5-7-15/h3-7,9-11,14,18H,8,12-13,29H2,1-2H3,(H,31,32,33)/b19-17?,30-11+ |
| InChIKey | UQHNKSQYPLAABS-ZKROBLKNSA-N |
| XLogP | 3.85 |
| TPSA | 96.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|