C23H25F5N6O — CID 174004247
2-amino-1-[(3R)-5,5-difluoro-3-methyl-2-[[[5-(trifluoromethyl)pyrazin-2-yl]amino]methyl]piperidin-1-yl]-4-methylimino-3-phenylbut-2-en-1-one (PubChem CID 174004247) has the molecular formula C23H25F5N6O and a molecular weight of 496.48 g/mol. Its IUPAC name is 2-amino-1-[(3R)-5,5-difluoro-3-methyl-2-[[[5-(trifluoromethyl)pyrazin-2-yl]amino]methyl]piperidin-1-yl]-4-methylimino-3-phenylbut-2-en-1-one.
| Compound Name | 2-amino-1-[(3R)-5,5-difluoro-3-methyl-2-[[[5-(trifluoromethyl)pyrazin-2-yl]amino]methyl]piperidin-1-yl]-4-methylimino-3-phenylbut-2-en-1-one |
|---|---|
| PubChem CID | 174004247 |
| Molecular Formula | C23H25F5N6O |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | 2-amino-1-[(3R)-5,5-difluoro-3-methyl-2-[[[5-(trifluoromethyl)pyrazin-2-yl]amino]methyl]piperidin-1-yl]-4-methylimino-3-phenylbut-2-en-1-one |
| SMILES | C/N=C/C(=C(N)C(=O)N1CC(F)(F)C[C@@H](C)C1CNc1cnc(C(F)(F)F)cn1)c1ccccc1 |
| InChI | InChI=1S/C23H25F5N6O/c1-14-8-22(24,25)13-34(17(14)10-32-19-12-31-18(11-33-19)23(26,27)28)21(35)20(29)16(9-30-2)15-6-4-3-5-7-15/h3-7,9,11-12,14,17H,8,10,13,29H2,1-2H3,(H,32,33)/b20-16?,30-9+/t14-,17?/m1/s1 |
| InChIKey | VPJFQSNKRTYZDL-OYUPSNCLSA-N |
| XLogP | 3.85 |
| TPSA | 96.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|