C22H24ClFN4 — CID 153266895
5-[2-(5-aminopentyl)-5-chloro-4-pyridinyl]-N-[(3-fluorophenyl)methyl]pyridin-3-amine (PubChem CID 153266895) has the molecular formula C22H24ClFN4 and a molecular weight of 398.91 g/mol. Its IUPAC name is 5-[2-(5-aminopentyl)-5-chloro-4-pyridinyl]-N-[(3-fluorophenyl)methyl]pyridin-3-amine.
| Compound Name | 5-[2-(5-aminopentyl)-5-chloro-4-pyridinyl]-N-[(3-fluorophenyl)methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 153266895 |
| Molecular Formula | C22H24ClFN4 |
| Molecular Weight | 398.91 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 5-[2-(5-aminopentyl)-5-chloro-4-pyridinyl]-N-[(3-fluorophenyl)methyl]pyridin-3-amine |
| SMILES | NCCCCCc1cc(-c2cncc(NCc3cccc(F)c3)c2)c(Cl)cn1 |
| InChI | InChI=1S/C22H24ClFN4/c23-22-15-28-19(7-2-1-3-8-25)11-21(22)17-10-20(14-26-13-17)27-12-16-5-4-6-18(24)9-16/h4-6,9-11,13-15,27H,1-3,7-8,12,25H2 |
| InChIKey | WWINLYFWISTGQF-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.91 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|