C44H32B2N2O2Pt — CID 153276354
CID 153276354 (PubChem CID 153276354) has the molecular formula C44H32B2N2O2Pt and a molecular weight of 837.45 g/mol.
| Compound Name | CID 153276354 |
|---|---|
| PubChem CID | 153276354 |
| Molecular Formula | C44H32B2N2O2Pt |
| Molecular Weight | 837.45 g/mol |
| Exact Mass | 837.23 |
| IUPAC Name | — |
| SMILES | Cc1cccc(C)c1B1c2ccccc2B(c2c(C)cccc2C)c2c3[c-]c(cc21)-c1cccc(n1)Oc1cccc(n1)-c1[c-]c(ccc1)O3.[Pt+2] |
| InChI | InChI=1S/C44H32B2N2O2.Pt/c1-27-12-7-13-28(2)42(27)45-34-18-5-6-19-35(34)46(43-29(3)14-8-15-30(43)4)44-36(45)25-32-26-39(44)49-33-17-9-16-31(24-33)37-20-10-22-40(47-37)50-41-23-11-21-38(32)48-41;/h5-23,25H,1-4H3;/q-2;+2 |
| InChIKey | QLNZVCVYEFRLAN-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.45 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|