C37H21N3O — CID 153277486
2-[9-[4-(2-isocyanophenyl)phenyl]dibenzofuran-2-yl]-1,10-phenanthroline (PubChem CID 153277486) has the molecular formula C37H21N3O and a molecular weight of 523.60 g/mol. Its IUPAC name is 2-[9-[4-(2-isocyanophenyl)phenyl]dibenzofuran-2-yl]-1,10-phenanthroline.
| Compound Name | 2-[9-[4-(2-isocyanophenyl)phenyl]dibenzofuran-2-yl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 153277486 |
| Molecular Formula | C37H21N3O |
| Molecular Weight | 523.60 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | 2-[9-[4-(2-isocyanophenyl)phenyl]dibenzofuran-2-yl]-1,10-phenanthroline |
| SMILES | [C-]#[N+]c1ccccc1-c1ccc(-c2cccc3oc4ccc(-c5ccc6ccc7cccnc7c6n5)cc4c23)cc1 |
| InChI | InChI=1S/C37H21N3O/c1-38-32-9-3-2-7-28(32)23-11-13-24(14-12-23)29-8-4-10-34-35(29)30-22-27(18-20-33(30)41-34)31-19-17-26-16-15-25-6-5-21-39-36(25)37(26)40-31/h2-22H |
| InChIKey | ROEJSPGJWPMMQE-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 43.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.60 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|